About N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide
N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 129203750) has the molecular formula C5H4IN3O3
and a molecular weight of 281.01 g/mol. Its IUPAC name is N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| PubChem CID | 129203750 |
| Molecular Formula | C5H4IN3O3 |
| Molecular Weight | 281.01 g/mol |
| Exact Mass | 280.93 |
| IUPAC Name | N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(NI)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H4IN3O3/c6-9-4(11)2-1-3(10)8-5(12)7-2/h1H,(H,9,11)(H2,7,8,10,12) |
| InChIKey | WGLZUTVAUONOJK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.01 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The IUPAC name of N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide (CID 129203750) is N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide.
What is the SMILES notation for N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The canonical SMILES for N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide is O=C(NI)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The InChIKey is WGLZUTVAUONOJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4IN3O3/c6-9-4(11)2-1-3(10)8-5(12)7-2/h1H,(H,9,11)(H2,7,8,10,12).
What are the key properties of N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide?
N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide has a molecular weight of 281.01 g/mol, XLogP of -0.86, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide is sourced from PubChem (CID 129203750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).