C5H4IN3O3 — CID 129203750
N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 129203750) has the molecular formula C5H4IN3O3 and a molecular weight of 281.01 g/mol. Its IUPAC name is N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 129203750 |
| Molecular Formula | C5H4IN3O3 |
| Molecular Weight | 281.01 g/mol |
| Exact Mass | 280.93 |
| IUPAC Name | N-iodo-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(NI)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H4IN3O3/c6-9-4(11)2-1-3(10)8-5(12)7-2/h1H,(H,9,11)(H2,7,8,10,12) |
| InChIKey | WGLZUTVAUONOJK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.01 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|