C13H13N3O3 — CID 110698301
N-(4-ethylphenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 110698301) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-(4-ethylphenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110698301 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(4-ethylphenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2cc(=O)[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C13H13N3O3/c1-2-8-3-5-9(6-4-8)14-12(18)10-7-11(17)16-13(19)15-10/h3-7H,2H2,1H3,(H,14,18)(H2,15,16,17,19) |
| InChIKey | HMVMKWMUBDPZAB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |