C16H15N3O2 — CID 110692366
N-(4-ethylphenyl)-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide (PubChem CID 110692366) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide.
| Compound Name | N-(4-ethylphenyl)-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110692366 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(4-ethylphenyl)-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2ccc3[nH]c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C16H15N3O2/c1-2-10-3-6-12(7-4-10)17-15(20)11-5-8-13-14(9-11)19-16(21)18-13/h3-9H,2H2,1H3,(H,17,20)(H2,18,19,21) |
| InChIKey | WEOXPWPKGTVPNZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |