C17H22N2O3 — CID 91772747
3-ethyl-N-[(3S,4R)-3-methoxyoxan-4-yl]-1H-indole-2-carboxamide (PubChem CID 91772747) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-ethyl-N-[(3S,4R)-3-methoxyoxan-4-yl]-1H-indole-2-carboxamide.
| Compound Name | 3-ethyl-N-[(3S,4R)-3-methoxyoxan-4-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91772747 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-ethyl-N-[(3S,4R)-3-methoxyoxan-4-yl]-1H-indole-2-carboxamide |
| SMILES | CCc1c(C(=O)N[C@@H]2CCOC[C@H]2OC)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N2O3/c1-3-11-12-6-4-5-7-13(12)18-16(11)17(20)19-14-8-9-22-10-15(14)21-2/h4-7,14-15,18H,3,8-10H2,1-2H3,(H,19,20)/t14-,15-/m1/s1 |
| InChIKey | XNQFCRMAWOPPHG-HUUCEWRRSA-N |
| XLogP | 2.26 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|