C15H16N2O4 — CID 154868176
N-[(3S,4S)-4-methoxyoxolan-3-yl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 154868176) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[(3S,4S)-4-methoxyoxolan-3-yl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[(3S,4S)-4-methoxyoxolan-3-yl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 154868176 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[(3S,4S)-4-methoxyoxolan-3-yl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CO[C@@H]1COC[C@@H]1NC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C15H16N2O4/c1-20-13-8-21-7-12(13)17-15(19)10-6-16-11-5-3-2-4-9(11)14(10)18/h2-6,12-13H,7-8H2,1H3,(H,16,18)(H,17,19)/t12-,13+/m0/s1 |
| InChIKey | LJTLUSJJLWDHPA-QWHCGFSZSA-N |
| XLogP | 0.67 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |