C16H18N2O3 — CID 104927982
N-[(1R,2R)-2-hydroxycyclohexyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 104927982) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 104927982 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C16H18N2O3/c19-14-8-4-3-7-13(14)18-16(21)11-9-17-12-6-2-1-5-10(12)15(11)20/h1-2,5-6,9,13-14,19H,3-4,7-8H2,(H,17,20)(H,18,21)/t13-,14-/m1/s1 |
| InChIKey | NUVRATOQVOCGGX-ZIAGYGMSSA-N |
| XLogP | 1.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |