About 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide
5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide (PubChem CID 107211254) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide |
| PubChem CID | 107211254 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide |
| SMILES | Nc1ccc2[nH]cc(C(=O)N[C@H]3CCCC[C@@H]3O)c2c1 |
| InChI | InChI=1S/C15H19N3O2/c16-9-5-6-12-10(7-9)11(8-17-12)15(20)18-13-3-1-2-4-14(13)19/h5-8,13-14,17,19H,1-4,16H2,(H,18,20)/t13-,14-/m0/s1 |
| InChIKey | CECMLNAMSJZWGK-KBPBESRZSA-N |
| XLogP | 1.78 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide?
The IUPAC name of 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide (CID 107211254) is 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide.
What is the SMILES notation for 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide?
The canonical SMILES for 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide is Nc1ccc2[nH]cc(C(=O)N[C@H]3CCCC[C@@H]3O)c2c1.
What is the InChIKey of 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide?
The InChIKey is CECMLNAMSJZWGK-KBPBESRZSA-N. The full InChI is InChI=1S/C15H19N3O2/c16-9-5-6-12-10(7-9)11(8-17-12)15(20)18-13-3-1-2-4-14(13)19/h5-8,13-14,17,19H,1-4,16H2,(H,18,20)/t13-,14-/m0/s1.
What are the key properties of 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide?
5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide has a molecular weight of 273.34 g/mol, XLogP of 1.78, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide is sourced from PubChem (CID 107211254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).