C15H16F2N2O2 — CID 122413541
4,5-difluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide (PubChem CID 122413541) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 4,5-difluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide.
| Compound Name | 4,5-difluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 122413541 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4,5-difluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-1H-indole-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1c[nH]c2ccc(F)c(F)c12 |
| InChI | InChI=1S/C15H16F2N2O2/c16-9-5-6-11-13(14(9)17)8(7-18-11)15(21)19-10-3-1-2-4-12(10)20/h5-7,10,12,18,20H,1-4H2,(H,19,21)/t10-,12-/m0/s1 |
| InChIKey | QJQKNBIDFAIDJK-JQWIXIFHSA-N |
| XLogP | 2.48 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |