C13H12F5NO2 — CID 102739213
2,3,4,5,6-pentafluoro-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide (PubChem CID 102739213) has the molecular formula C13H12F5NO2 and a molecular weight of 309.23 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 102739213 |
| Molecular Formula | C13H12F5NO2 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H12F5NO2/c14-8-7(9(15)11(17)12(18)10(8)16)13(21)19-5-3-1-2-4-6(5)20/h5-6,20H,1-4H2,(H,19,21)/t5-,6-/m1/s1 |
| InChIKey | KQMOVNBNWSXYRL-PHDIDXHHSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|