C13H15ClFNO2 — CID 104956755
2-chloro-3-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]benzamide (PubChem CID 104956755) has the molecular formula C13H15ClFNO2 and a molecular weight of 271.72 g/mol. Its IUPAC name is 2-chloro-3-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]benzamide.
| Compound Name | 2-chloro-3-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 104956755 |
| Molecular Formula | C13H15ClFNO2 |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-chloro-3-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]benzamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1cccc(F)c1Cl |
| InChI | InChI=1S/C13H15ClFNO2/c14-12-8(4-3-5-9(12)15)13(18)16-10-6-1-2-7-11(10)17/h3-5,10-11,17H,1-2,6-7H2,(H,16,18)/t10-,11-/m0/s1 |
| InChIKey | GPZUWKLOPBTINN-QWRGUYRKSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |