C13H16FNO4 — CID 110166110
N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-3-fluoro-2-hydroxybenzamide (PubChem CID 110166110) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-3-fluoro-2-hydroxybenzamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-3-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 110166110 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-3-fluoro-2-hydroxybenzamide |
| SMILES | O=C(N[C@@H]1CCC[C@@H](O)[C@@H]1O)c1cccc(F)c1O |
| InChI | InChI=1S/C13H16FNO4/c14-8-4-1-3-7(11(8)17)13(19)15-9-5-2-6-10(16)12(9)18/h1,3-4,9-10,12,16-18H,2,5-6H2,(H,15,19)/t9-,10-,12-/m1/s1 |
| InChIKey | NYPXEAHKUMCMII-CKYFFXLPSA-N |
| XLogP | 0.54 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |