C12H14ClNO3 — CID 110125116
2-chloro-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]benzamide (PubChem CID 110125116) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]benzamide.
| Compound Name | 2-chloro-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]benzamide |
|---|---|
| PubChem CID | 110125116 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-chloro-N-[(1R,2R,3R)-2,3-dihydroxycyclopentyl]benzamide |
| SMILES | O=C(N[C@@H]1CC[C@@H](O)[C@@H]1O)c1ccccc1Cl |
| InChI | InChI=1S/C12H14ClNO3/c13-8-4-2-1-3-7(8)12(17)14-9-5-6-10(15)11(9)16/h1-4,9-11,15-16H,5-6H2,(H,14,17)/t9-,10-,11-/m1/s1 |
| InChIKey | FECBMLOWPLQZQJ-GMTAPVOTSA-N |
| XLogP | 0.95 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |