C16H14ClNO — CID 26288569
2-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 26288569) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 2-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 26288569 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | O=C(N[C@H]1CCc2ccccc21)c1ccccc1Cl |
| InChI | InChI=1S/C16H14ClNO/c17-14-8-4-3-7-13(14)16(19)18-15-10-9-11-5-1-2-6-12(11)15/h1-8,15H,9-10H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | MBTSGRRVOPIJLL-HNNXBMFYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |