C16H14ClFN2O — CID 81266310
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-2-fluorobenzamide (PubChem CID 81266310) has the molecular formula C16H14ClFN2O and a molecular weight of 304.75 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-2-fluorobenzamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 81266310 |
| Molecular Formula | C16H14ClFN2O |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-2-fluorobenzamide |
| SMILES | Nc1ccc2c(c1)CCC2NC(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C16H14ClFN2O/c17-13-3-1-2-12(15(13)18)16(21)20-14-7-4-9-8-10(19)5-6-11(9)14/h1-3,5-6,8,14H,4,7,19H2,(H,20,21) |
| InChIKey | GKZTYQMLQGAEGQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|