C16H14ClIN2O — CID 103209666
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-4-iodobenzamide (PubChem CID 103209666) has the molecular formula C16H14ClIN2O and a molecular weight of 412.66 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-4-iodobenzamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-4-iodobenzamide |
|---|---|
| PubChem CID | 103209666 |
| Molecular Formula | C16H14ClIN2O |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-4-iodobenzamide |
| SMILES | Nc1ccc2c(c1)CCC2NC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClIN2O/c17-13-8-10(1-5-14(13)18)16(21)20-15-6-2-9-7-11(19)3-4-12(9)15/h1,3-5,7-8,15H,2,6,19H2,(H,20,21) |
| InChIKey | SNEWDSUGPHKOOB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|