C17H17IN2O — CID 116649897
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-iodobenzamide (PubChem CID 116649897) has the molecular formula C17H17IN2O and a molecular weight of 392.24 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-iodobenzamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-iodobenzamide |
|---|---|
| PubChem CID | 116649897 |
| Molecular Formula | C17H17IN2O |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-iodobenzamide |
| SMILES | Nc1ccc2c(c1)CCCC2NC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C17H17IN2O/c18-13-5-1-4-12(9-13)17(21)20-16-6-2-3-11-10-14(19)7-8-15(11)16/h1,4-5,7-10,16H,2-3,6,19H2,(H,20,21) |
| InChIKey | CRYAUORWRIYDON-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|