C16H15BrN2O — CID 79740821
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-4-bromobenzamide (PubChem CID 79740821) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-4-bromobenzamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-4-bromobenzamide |
|---|---|
| PubChem CID | 79740821 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-4-bromobenzamide |
| SMILES | Nc1ccc2c(c1)CCC2NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrN2O/c17-12-4-1-10(2-5-12)16(20)19-15-8-3-11-9-13(18)6-7-14(11)15/h1-2,4-7,9,15H,3,8,18H2,(H,19,20) |
| InChIKey | AFAURBCCKWWBFT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|