C16H16BrN3O — CID 116649702
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-5-bromopyridine-3-carboxamide (PubChem CID 116649702) has the molecular formula C16H16BrN3O and a molecular weight of 346.23 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-5-bromopyridine-3-carboxamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-5-bromopyridine-3-carboxamide |
|---|---|
| PubChem CID | 116649702 |
| Molecular Formula | C16H16BrN3O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-5-bromopyridine-3-carboxamide |
| SMILES | Nc1ccc2c(c1)CCCC2NC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C16H16BrN3O/c17-12-6-11(8-19-9-12)16(21)20-15-3-1-2-10-7-13(18)4-5-14(10)15/h4-9,15H,1-3,18H2,(H,20,21) |
| InChIKey | CNXIJYOAMHHVNM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|