About N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide (PubChem CID 107940112) has the molecular formula C16H14BrClN2O
and a molecular weight of 365.66 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide.
Molecular Properties
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide |
| PubChem CID | 107940112 |
| Molecular Formula | C16H14BrClN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide |
| SMILES | Nc1ccc2c(c1)CCC2NC(=O)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C16H14BrClN2O/c17-11-5-10(6-12(18)8-11)16(21)20-15-4-1-9-7-13(19)2-3-14(9)15/h2-3,5-8,15H,1,4,19H2,(H,20,21) |
| InChIKey | MXFVWZXIRVRXOC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide?
The IUPAC name of N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide (CID 107940112) is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide.
What is the SMILES notation for N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide?
The canonical SMILES for N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide is Nc1ccc2c(c1)CCC2NC(=O)c1cc(Cl)cc(Br)c1.
What is the InChIKey of N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide?
The InChIKey is MXFVWZXIRVRXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrClN2O/c17-11-5-10(6-12(18)8-11)16(21)20-15-4-1-9-7-13(19)2-3-14(9)15/h2-3,5-8,15H,1,4,19H2,(H,20,21).
What are the key properties of N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide?
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide has a molecular weight of 365.66 g/mol, XLogP of 4.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-bromo-5-chlorobenzamide is sourced from PubChem (CID 107940112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).