C17H17ClN2O — CID 81316696
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-5-methylbenzamide (PubChem CID 81316696) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-5-methylbenzamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-5-methylbenzamide |
|---|---|
| PubChem CID | 81316696 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-3-chloro-5-methylbenzamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NC2CCc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C17H17ClN2O/c1-10-6-12(8-13(18)7-10)17(21)20-16-5-2-11-9-14(19)3-4-15(11)16/h3-4,6-9,16H,2,5,19H2,1H3,(H,20,21) |
| InChIKey | IPRVIUVJFMHFPR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|