C15H16BrN3O — CID 79741368
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-4-bromo-1-methylpyrrole-2-carboxamide (PubChem CID 79741368) has the molecular formula C15H16BrN3O and a molecular weight of 334.22 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-4-bromo-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-4-bromo-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79741368 |
| Molecular Formula | C15H16BrN3O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-4-bromo-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)NC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H16BrN3O/c1-19-8-10(16)7-14(19)15(20)18-13-5-2-9-6-11(17)3-4-12(9)13/h3-4,6-8,13H,2,5,17H2,1H3,(H,18,20) |
| InChIKey | KZATVKMYEMLIQD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|