C17H19N3O — CID 116649861
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-pyridin-3-ylacetamide (PubChem CID 116649861) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-pyridin-3-ylacetamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 116649861 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-pyridin-3-ylacetamide |
| SMILES | Nc1ccc2c(c1)CCCC2NC(=O)Cc1cccnc1 |
| InChI | InChI=1S/C17H19N3O/c18-14-6-7-15-13(10-14)4-1-5-16(15)20-17(21)9-12-3-2-8-19-11-12/h2-3,6-8,10-11,16H,1,4-5,9,18H2,(H,20,21) |
| InChIKey | LDOBWOCVEMNJEV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|