C16H22N2O — CID 116649737
(Z)-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methylpent-2-enamide (PubChem CID 116649737) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is (Z)-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methylpent-2-enamide.
| Compound Name | (Z)-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 116649737 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (Z)-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NC1CCCc2cc(N)ccc21 |
| InChI | InChI=1S/C16H22N2O/c1-3-5-11(2)16(19)18-15-7-4-6-12-10-13(17)8-9-14(12)15/h5,8-10,15H,3-4,6-7,17H2,1-2H3,(H,18,19)/b11-5- |
| InChIKey | STUAQFCNWFSKSE-WZUFQYTHSA-N |
| XLogP | 3.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|