C15H17N3O2S — CID 116650196
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-3-sulfonamide (PubChem CID 116650196) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-3-sulfonamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 116650196 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-3-sulfonamide |
| SMILES | Nc1ccc2c(c1)CCCC2NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C15H17N3O2S/c16-12-6-7-14-11(9-12)3-1-5-15(14)18-21(19,20)13-4-2-8-17-10-13/h2,4,6-10,15,18H,1,3,5,16H2 |
| InChIKey | FKRFFFZIMRYXSC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|