C17H17F3N2O2S — CID 120721935
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 120721935) has the molecular formula C17H17F3N2O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120721935 |
| Molecular Formula | C17H17F3N2O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Nc1ccc2c(c1)CCCC2NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O2S/c18-17(19,20)12-4-2-5-14(10-12)25(23,24)22-16-6-1-3-11-9-13(21)7-8-15(11)16/h2,4-5,7-10,16,22H,1,3,6,21H2 |
| InChIKey | YTFNOTRYBFICQB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|