C17H21ClN2O4S2 — CID 120722353
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-methylsulfonylbenzenesulfonamide;hydrochloride (PubChem CID 120722353) has the molecular formula C17H21ClN2O4S2 and a molecular weight of 416.95 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-methylsulfonylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-methylsulfonylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120722353 |
| Molecular Formula | C17H21ClN2O4S2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-methylsulfonylbenzenesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NC2CCCc3cc(N)ccc32)cc1.Cl |
| InChI | InChI=1S/C17H20N2O4S2.ClH/c1-24(20,21)14-6-8-15(9-7-14)25(22,23)19-17-4-2-3-12-11-13(18)5-10-16(12)17;/h5-11,17,19H,2-4,18H2,1H3;1H |
| InChIKey | KDLVCWOFLWTVRV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|