C17H19N3O4S — CID 120721988
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-methyl-4-nitrobenzenesulfonamide (PubChem CID 120721988) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-methyl-4-nitrobenzenesulfonamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-methyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120721988 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-3-methyl-4-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCCc3cc(N)ccc32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19N3O4S/c1-11-9-14(6-8-17(11)20(21)22)25(23,24)19-16-4-2-3-12-10-13(18)5-7-15(12)16/h5-10,16,19H,2-4,18H2,1H3 |
| InChIKey | PKOUNQPOYHBCIN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|