C19H23N3O3S — CID 120722247
N-[5-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-2-methylphenyl]acetamide (PubChem CID 120722247) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[5-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-2-methylphenyl]acetamide.
| Compound Name | N-[5-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 120722247 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[5-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-2-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)NC2CCCc3cc(N)ccc32)ccc1C |
| InChI | InChI=1S/C19H23N3O3S/c1-12-6-8-16(11-19(12)21-13(2)23)26(24,25)22-18-5-3-4-14-10-15(20)7-9-17(14)18/h6-11,18,22H,3-5,20H2,1-2H3,(H,21,23) |
| InChIKey | QFGSXXWOPHVTCQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|