C20H24ClN3O3S — CID 120721948
1-acetyl-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydroindole-5-sulfonamide;hydrochloride (PubChem CID 120721948) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is 1-acetyl-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydroindole-5-sulfonamide;hydrochloride.
| Compound Name | 1-acetyl-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydroindole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120721948 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-acetyl-N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dihydroindole-5-sulfonamide;hydrochloride |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)NC3CCCc4cc(N)ccc43)ccc21.Cl |
| InChI | InChI=1S/C20H23N3O3S.ClH/c1-13(24)23-10-9-15-12-17(6-8-20(15)23)27(25,26)22-19-4-2-3-14-11-16(21)5-7-18(14)19;/h5-8,11-12,19,22H,2-4,9-10,21H2,1H3;1H |
| InChIKey | CHOIVQIFYSVHOA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|