C14H16N2O4S2 — CID 40830687
1-acetyl-N-[(3R)-2-oxothiolan-3-yl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 40830687) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-acetyl-N-[(3R)-2-oxothiolan-3-yl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-[(3R)-2-oxothiolan-3-yl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 40830687 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-acetyl-N-[(3R)-2-oxothiolan-3-yl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)N[C@@H]3CCSC3=O)ccc21 |
| InChI | InChI=1S/C14H16N2O4S2/c1-9(17)16-6-4-10-8-11(2-3-13(10)16)22(19,20)15-12-5-7-21-14(12)18/h2-3,8,12,15H,4-7H2,1H3/t12-/m1/s1 |
| InChIKey | IYQMHQBTVWMVON-GFCCVEGCSA-N |
| XLogP | 0.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|