C15H17F3N4O2S — CID 120722213
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide (PubChem CID 120722213) has the molecular formula C15H17F3N4O2S and a molecular weight of 374.39 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 120722213 |
| Molecular Formula | C15H17F3N4O2S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide |
| SMILES | Nc1ccc2c(c1)CCCC2NS(=O)(=O)c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N4O2S/c16-15(17,18)9-22-8-12(7-20-22)25(23,24)21-14-3-1-2-10-6-11(19)4-5-13(10)14/h4-8,14,21H,1-3,9,19H2 |
| InChIKey | CNHKLWRPFZPOBB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|