C13H16N4O2S — CID 116650187
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole-5-sulfonamide (PubChem CID 116650187) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole-5-sulfonamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 116650187 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole-5-sulfonamide |
| SMILES | Nc1ccc2c(c1)CCCC2NS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C13H16N4O2S/c14-10-4-5-11-9(6-10)2-1-3-12(11)17-20(18,19)13-7-15-8-16-13/h4-8,12,17H,1-3,14H2,(H,15,16) |
| InChIKey | RECFZXDZLLCZQJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|