C16H16Cl2N2O2S — CID 120721939
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dichlorobenzenesulfonamide (PubChem CID 120721939) has the molecular formula C16H16Cl2N2O2S and a molecular weight of 371.29 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dichlorobenzenesulfonamide.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 120721939 |
| Molecular Formula | C16H16Cl2N2O2S |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dichlorobenzenesulfonamide |
| SMILES | Nc1ccc2c(c1)CCCC2NS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl2N2O2S/c17-13-4-2-6-15(16(13)18)23(21,22)20-14-5-1-3-10-9-11(19)7-8-12(10)14/h2,4,6-9,14,20H,1,3,5,19H2 |
| InChIKey | PKVYBFNTJWKBPC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|