C18H20ClN3O2S — CID 120722480
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-cyano-3-methylbenzenesulfonamide;hydrochloride (PubChem CID 120722480) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-cyano-3-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-cyano-3-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120722480 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-cyano-3-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1cccc(S(=O)(=O)NC2CCCc3cc(N)ccc32)c1C#N.Cl |
| InChI | InChI=1S/C18H19N3O2S.ClH/c1-12-4-2-7-18(16(12)11-19)24(22,23)21-17-6-3-5-13-10-14(20)8-9-15(13)17;/h2,4,7-10,17,21H,3,5-6,20H2,1H3;1H |
| InChIKey | VYIHRORYXFBZJB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|