C18H20ClN3O3S — CID 120876321
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-cyano-2-methoxybenzenesulfonamide;hydrochloride (PubChem CID 120876321) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-cyano-2-methoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-cyano-2-methoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120876321 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-cyano-2-methoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1cc(C#N)ccc1S(=O)(=O)NC1CCCc2cc(N)ccc21.Cl |
| InChI | InChI=1S/C18H19N3O3S.ClH/c1-24-17-9-12(11-19)5-8-18(17)25(22,23)21-16-4-2-3-13-10-14(20)6-7-15(13)16;/h5-10,16,21H,2-4,20H2,1H3;1H |
| InChIKey | CCPASIBGMVUXCJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|