C17H20ClN3O5S — CID 120722399
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methoxy-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120722399) has the molecular formula C17H20ClN3O5S and a molecular weight of 413.88 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methoxy-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methoxy-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120722399 |
| Molecular Formula | C17H20ClN3O5S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-methoxy-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1S(=O)(=O)NC1CCCc2cc(N)ccc21.Cl |
| InChI | InChI=1S/C17H19N3O5S.ClH/c1-25-16-8-6-13(20(21)22)10-17(16)26(23,24)19-15-4-2-3-11-9-12(18)5-7-14(11)15;/h5-10,15,19H,2-4,18H2,1H3;1H |
| InChIKey | FLKMEYJJSGQQJS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|