C18H20ClN3O3S — CID 155718277
N-(5-chloro-2,3-dihydro-1H-inden-1-yl)-4-(dimethylsulfamoylamino)benzamide (PubChem CID 155718277) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is N-(5-chloro-2,3-dihydro-1H-inden-1-yl)-4-(dimethylsulfamoylamino)benzamide.
| Compound Name | N-(5-chloro-2,3-dihydro-1H-inden-1-yl)-4-(dimethylsulfamoylamino)benzamide |
|---|---|
| PubChem CID | 155718277 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-(5-chloro-2,3-dihydro-1H-inden-1-yl)-4-(dimethylsulfamoylamino)benzamide |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(C(=O)NC2CCc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C18H20ClN3O3S/c1-22(2)26(24,25)21-15-7-3-12(4-8-15)18(23)20-17-10-5-13-11-14(19)6-9-16(13)17/h3-4,6-9,11,17,21H,5,10H2,1-2H3,(H,20,23) |
| InChIKey | IRBYZQOXPUVTDS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |