C16H13Cl2NO2 — CID 164939975
5-chloro-N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-hydroxybenzamide (PubChem CID 164939975) has the molecular formula C16H13Cl2NO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 164939975 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 5-chloro-N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-hydroxybenzamide |
| SMILES | O=C(N[C@@H]1CCc2cc(Cl)ccc21)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H13Cl2NO2/c17-10-2-4-12-9(7-10)1-5-14(12)19-16(21)13-8-11(18)3-6-15(13)20/h2-4,6-8,14,20H,1,5H2,(H,19,21)/t14-/m1/s1 |
| InChIKey | WXWHPJKHEMYYKO-CQSZACIVSA-N |
| XLogP | 4.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |