C17H14ClFN2OS — CID 171794326
N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-5-fluoro-2,3-dihydro-1,2-benzothiazole-6-carboxamide (PubChem CID 171794326) has the molecular formula C17H14ClFN2OS and a molecular weight of 348.83 g/mol. Its IUPAC name is N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-5-fluoro-2,3-dihydro-1,2-benzothiazole-6-carboxamide.
| Compound Name | N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-5-fluoro-2,3-dihydro-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 171794326 |
| Molecular Formula | C17H14ClFN2OS |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-5-fluoro-2,3-dihydro-1,2-benzothiazole-6-carboxamide |
| SMILES | O=C(N[C@@H]1CCc2cc(Cl)ccc21)c1cc2c(cc1F)CNS2 |
| InChI | InChI=1S/C17H14ClFN2OS/c18-11-2-3-12-9(5-11)1-4-15(12)21-17(22)13-7-16-10(6-14(13)19)8-20-23-16/h2-3,5-7,15,20H,1,4,8H2,(H,21,22)/t15-/m1/s1 |
| InChIKey | WYJUITKTCSXYQX-OAHLLOKOSA-N |
| XLogP | 4.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|