C18H14ClFN2O3S — CID 171794325
carbon dioxide;N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-5-fluoro-2,3-dihydro-1,2-benzothiazole-6-carboxamide (PubChem CID 171794325) has the molecular formula C18H14ClFN2O3S and a molecular weight of 392.84 g/mol. Its IUPAC name is carbon dioxide;N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-5-fluoro-2,3-dihydro-1,2-benzothiazole-6-carboxamide.
| Compound Name | carbon dioxide;N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-5-fluoro-2,3-dihydro-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 171794325 |
| Molecular Formula | C18H14ClFN2O3S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | carbon dioxide;N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-5-fluoro-2,3-dihydro-1,2-benzothiazole-6-carboxamide |
| SMILES | O=C(N[C@@H]1CCc2cc(Cl)ccc21)c1cc2c(cc1F)CNS2.O=C=O |
| InChI | InChI=1S/C17H14ClFN2OS.CO2/c18-11-2-3-12-9(5-11)1-4-15(12)21-17(22)13-7-16-10(6-14(13)19)8-20-23-16;2-1-3/h2-3,5-7,15,20H,1,4,8H2,(H,21,22);/t15-;/m1./s1 |
| InChIKey | ATTKDCUXGOSTFP-XFULWGLBSA-N |
| XLogP | 3.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|