C15H15NO2 — CID 47015555
N-(2,3-dihydro-1H-inden-1-yl)-2-methylfuran-3-carboxamide (PubChem CID 47015555) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 47015555 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C15H15NO2/c1-10-12(8-9-18-10)15(17)16-14-7-6-11-4-2-3-5-13(11)14/h2-5,8-9,14H,6-7H2,1H3,(H,16,17) |
| InChIKey | QXRALYIMBZRIFE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |