C17H14ClNO3 — CID 59505213
(3R)-3-[(2-chlorobenzoyl)amino]-2,3-dihydro-1H-indene-4-carboxylic acid (PubChem CID 59505213) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is (3R)-3-[(2-chlorobenzoyl)amino]-2,3-dihydro-1H-indene-4-carboxylic acid.
| Compound Name | (3R)-3-[(2-chlorobenzoyl)amino]-2,3-dihydro-1H-indene-4-carboxylic acid |
|---|---|
| PubChem CID | 59505213 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (3R)-3-[(2-chlorobenzoyl)amino]-2,3-dihydro-1H-indene-4-carboxylic acid |
| SMILES | O=C(N[C@@H]1CCc2cccc(C(=O)O)c21)c1ccccc1Cl |
| InChI | InChI=1S/C17H14ClNO3/c18-13-7-2-1-5-11(13)16(20)19-14-9-8-10-4-3-6-12(15(10)14)17(21)22/h1-7,14H,8-9H2,(H,19,20)(H,21,22)/t14-/m1/s1 |
| InChIKey | BQGSQOJLJNORRH-CQSZACIVSA-N |
| XLogP | 3.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |