C19H27ClN2O — CID 24872464
2-chloro-N-[(1R,2S)-2-(piperidin-1-ylmethyl)cyclohexyl]benzamide (PubChem CID 24872464) has the molecular formula C19H27ClN2O and a molecular weight of 334.89 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2S)-2-(piperidin-1-ylmethyl)cyclohexyl]benzamide.
| Compound Name | 2-chloro-N-[(1R,2S)-2-(piperidin-1-ylmethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 24872464 |
| Molecular Formula | C19H27ClN2O |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-chloro-N-[(1R,2S)-2-(piperidin-1-ylmethyl)cyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1CN1CCCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C19H27ClN2O/c20-17-10-4-3-9-16(17)19(23)21-18-11-5-2-8-15(18)14-22-12-6-1-7-13-22/h3-4,9-10,15,18H,1-2,5-8,11-14H2,(H,21,23)/t15-,18+/m0/s1 |
| InChIKey | AQHBCHPZFIIQIS-MAUKXSAKSA-N |
| XLogP | 4.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |