C21H28N2OS — CID 24871627
N-[(1R,2S)-2-(piperidin-1-ylmethyl)cyclohexyl]-1-benzothiophene-3-carboxamide (PubChem CID 24871627) has the molecular formula C21H28N2OS and a molecular weight of 356.53 g/mol. Its IUPAC name is N-[(1R,2S)-2-(piperidin-1-ylmethyl)cyclohexyl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-(piperidin-1-ylmethyl)cyclohexyl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 24871627 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[(1R,2S)-2-(piperidin-1-ylmethyl)cyclohexyl]-1-benzothiophene-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1CN1CCCCC1)c1csc2ccccc12 |
| InChI | InChI=1S/C21H28N2OS/c24-21(18-15-25-20-11-5-3-9-17(18)20)22-19-10-4-2-8-16(19)14-23-12-6-1-7-13-23/h3,5,9,11,15-16,19H,1-2,4,6-8,10,12-14H2,(H,22,24)/t16-,19+/m0/s1 |
| InChIKey | BXAHTOXDQBABSX-QFBILLFUSA-N |
| XLogP | 4.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |