C16H19NO3S2 — CID 122158928
N-[(1R,2R)-2-methylsulfonylcyclohexyl]-1-benzothiophene-3-carboxamide (PubChem CID 122158928) has the molecular formula C16H19NO3S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylsulfonylcyclohexyl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(1R,2R)-2-methylsulfonylcyclohexyl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 122158928 |
| Molecular Formula | C16H19NO3S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-[(1R,2R)-2-methylsulfonylcyclohexyl]-1-benzothiophene-3-carboxamide |
| SMILES | CS(=O)(=O)[C@@H]1CCCC[C@H]1NC(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C16H19NO3S2/c1-22(19,20)15-9-5-3-7-13(15)17-16(18)12-10-21-14-8-4-2-6-11(12)14/h2,4,6,8,10,13,15H,3,5,7,9H2,1H3,(H,17,18)/t13-,15-/m1/s1 |
| InChIKey | WTBSTBIFHKSGSQ-UKRRQHHQSA-N |
| XLogP | 2.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |