C16H19NOS — CID 114550457
N-(3,3-dimethylcyclopentyl)-1-benzothiophene-3-carboxamide (PubChem CID 114550457) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-1-benzothiophene-3-carboxamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 114550457 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-1-benzothiophene-3-carboxamide |
| SMILES | CC1(C)CCC(NC(=O)c2csc3ccccc23)C1 |
| InChI | InChI=1S/C16H19NOS/c1-16(2)8-7-11(9-16)17-15(18)13-10-19-14-6-4-3-5-12(13)14/h3-6,10-11H,7-9H2,1-2H3,(H,17,18) |
| InChIKey | RFTQPSHPCVJXBC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |