C11H16N2OS — CID 115880619
N-(3,3-dimethylcyclopentyl)-1,3-thiazole-4-carboxamide (PubChem CID 115880619) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 115880619 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC1(C)CCC(NC(=O)c2cscn2)C1 |
| InChI | InChI=1S/C11H16N2OS/c1-11(2)4-3-8(5-11)13-10(14)9-6-15-7-12-9/h6-8H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | PPUKGDWKUQHAME-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |