C9H13N3OS — CID 23113297
N-piperidin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 23113297) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is N-piperidin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-piperidin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 23113297 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-piperidin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1cscn1 |
| InChI | InChI=1S/C9H13N3OS/c13-9(8-5-14-6-11-8)12-7-1-3-10-4-2-7/h5-7,10H,1-4H2,(H,12,13) |
| InChIKey | ICTORDUZIFENJZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |