C9H13N3O2S — CID 76982257
N-(4-methoxypyrrolidin-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 76982257) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is N-(4-methoxypyrrolidin-3-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-methoxypyrrolidin-3-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 76982257 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-(4-methoxypyrrolidin-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | COC1CNCC1NC(=O)c1cscn1 |
| InChI | InChI=1S/C9H13N3O2S/c1-14-8-3-10-2-6(8)12-9(13)7-4-15-5-11-7/h4-6,8,10H,2-3H2,1H3,(H,12,13) |
| InChIKey | RGZUHNWULDLUDH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |