C10H14N2O3S — CID 103533846
(3,4-dimethoxypyrrolidin-1-yl)-(1,3-thiazol-4-yl)methanone (PubChem CID 103533846) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is (3,4-dimethoxypyrrolidin-1-yl)-(1,3-thiazol-4-yl)methanone.
| Compound Name | (3,4-dimethoxypyrrolidin-1-yl)-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 103533846 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (3,4-dimethoxypyrrolidin-1-yl)-(1,3-thiazol-4-yl)methanone |
| SMILES | COC1CN(C(=O)c2cscn2)CC1OC |
| InChI | InChI=1S/C10H14N2O3S/c1-14-8-3-12(4-9(8)15-2)10(13)7-5-16-6-11-7/h5-6,8-9H,3-4H2,1-2H3 |
| InChIKey | PEKLNLUAQLYADL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |